CAS 2766343-90-0 is the registry number for 2-(2-Amino-3,5-dibromophenyl)ethan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-amino-3,5-dibromophenyl)ethanol (CAS 2766343-90-0) is a chemical compound with the molecular formula C8H9Br2NO and a molecular weight of 294.97 g/mol. IUPAC name: 2-(2-amino-3,5-dibromophenyl)ethanol. InChIKey: UXOILFRJWFJHER-UHFFFAOYSA-N.
| Molecular formula | C8H9Br2NO |
|---|---|
| Molecular weight | 294.97 g/mol |
| IUPAC name | 2-(2-amino-3,5-dibromophenyl)ethanol |
| InChIKey | UXOILFRJWFJHER-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1CCO)N)Br)Br |
Computed by PubChem (NCBI)