CAS 1349717-87-8 is the registry number for 3,5-Difluoro-4-(oxetan-3-yloxy)benzoic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
3,5-difluoro-4-(oxetan-3-yloxy)benzoic acid (CAS 1349717-87-8) is a chemical compound with the molecular formula C10H8F2O4 and a molecular weight of 230.16 g/mol. IUPAC name: 3,5-difluoro-4-(oxetan-3-yloxy)benzoic acid. InChIKey: CZFAHXITHNSBSF-UHFFFAOYSA-N.
| Molecular formula | C10H8F2O4 |
|---|---|
| Molecular weight | 230.16 g/mol |
| IUPAC name | 3,5-difluoro-4-(oxetan-3-yloxy)benzoic acid |
| InChIKey | CZFAHXITHNSBSF-UHFFFAOYSA-N |
| SMILES | C1C(CO1)OC2=C(C=C(C=C2F)C(=O)O)F |
Computed by PubChem (NCBI)