CAS 247018-46-8 appears in our catalog under these names: Boc-D-Tyrosinol, 95%, (R)-tert-Butyl (1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl)carbamate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
Tert-butyl N-[(2R)-1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]carbamate (CAS 247018-46-8) is a chemical compound with the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. IUPAC name: tert-butyl N-[(2R)-1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]carbamate. InChIKey: KMVXZPOLHFZPKW-LLVKDONJSA-N.
| Molecular formula | C14H21NO4 |
|---|---|
| Molecular weight | 267.32 g/mol |
| IUPAC name | tert-butyl N-[(2R)-1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]carbamate |
| InChIKey | KMVXZPOLHFZPKW-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC=C(C=C1)O)CO |
Computed by PubChem (NCBI)