Products 879324-75-1
CAS 879324-75-1 appears in our catalog under these names: Prionoid B, Prionoid B. Offered by: GLPBio, Biosynth. Available pack sizes: 5mg, 25mg, 10mg, 50mg.
12-hydroxy-6-methyl-3-(2-methylprop-1-enyl)-11-propan-2-yl-2-oxatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-4-one (CAS 879324-75-1) is a chemical compound with the molecular formula C20H22O3 and a molecular weight of 310.4 g/mol. IUPAC name: 12-hydroxy-6-methyl-3-(2-methylprop-1-enyl)-11-propan-2-yl-2-oxatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-4-one. InChIKey: WLCQIECMEDJZSS-UHFFFAOYSA-N.
| Molecular formula | C20H22O3 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | 12-hydroxy-6-methyl-3-(2-methylprop-1-enyl)-11-propan-2-yl-2-oxatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-4-one |
| InChIKey | WLCQIECMEDJZSS-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=O)C(OC3=C2C(=CC(=C3O)C(C)C)C=C1)C=C(C)C |
Computed by PubChem (NCBI)
Synonyms:
Prionoid B, orb1992551