CAS 1350475-42-1 appears in our catalog under these names: 1-Boc-4-(cyanomethyl)-4-piperidine carboxylic acid methyl ester, 95%, 1–tert–Butyl 4–methyl 4–(cyanomethyl)piperidine–1,4–dicarboxylate, 1-tert-Butyl 4-methyl 4-(cyanomethyl)piperidine-1,4-dicarboxylate 95%, 1-tert-butyl 4-methyl 4-(cyanomethyl)piperidine-1,4-dicarboxylate, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g, 25g.
1-O-tert-butyl 4-O-methyl 4-(cyanomethyl)piperidine-1,4-dicarboxylate (CAS 1350475-42-1) is a chemical compound with the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. IUPAC name: 1-O-tert-butyl 4-O-methyl 4-(cyanomethyl)piperidine-1,4-dicarboxylate. InChIKey: UQRMOFVFJWSNEV-UHFFFAOYSA-N.
| Molecular formula | C14H22N2O4 |
|---|---|
| Molecular weight | 282.34 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-methyl 4-(cyanomethyl)piperidine-1,4-dicarboxylate |
| InChIKey | UQRMOFVFJWSNEV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(CC#N)C(=O)OC |
Computed by PubChem (NCBI)