CAS 796067-46-4 appears in our catalog under these names: (8-tert-Butyl-2,4-dioxo-1,3-diazaspiro[4.5]dec-3-yl)acetic acid, 95%, 2-{8-tert-butyl-2,4-dioxo-1,3-diazaspiro(4.5)decan-3-yl}acetic acid, 95%, (8–tert–butyl–2,4–dioxo–1,3–diazaspiro(4·5)dec–3–yl)acetic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetic acid (CAS 796067-46-4) is a chemical compound with the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. IUPAC name: 2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetic acid. InChIKey: SLVGEMBPBCBIGF-UHFFFAOYSA-N.
| Molecular formula | C14H22N2O4 |
|---|---|
| Molecular weight | 282.34 g/mol |
| IUPAC name | 2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetic acid |
| InChIKey | SLVGEMBPBCBIGF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CCC2(CC1)C(=O)N(C(=O)N2)CC(=O)O |
Computed by PubChem (NCBI)