CAS 2102472-99-9 is the registry number for 1,3-Bis((tetrahydrofuran-2-yl)methyl)-imidazolium formate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
1,3-bis(oxolan-2-ylmethyl)imidazol-1-ium formate (CAS 2102472-99-9) is a chemical compound with the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. IUPAC name: 1,3-bis(oxolan-2-ylmethyl)imidazol-1-ium formate. InChIKey: XHCWXQGCQPKOKQ-UHFFFAOYSA-M.
| Molecular formula | C14H22N2O4 |
|---|---|
| Molecular weight | 282.34 g/mol |
| IUPAC name | 1,3-bis(oxolan-2-ylmethyl)imidazol-1-ium formate |
| InChIKey | XHCWXQGCQPKOKQ-UHFFFAOYSA-M |
| SMILES | C1CC(OC1)CN2C=C[N+](=C2)CC3CCCO3.C(=O)[O-] |
Computed by PubChem (NCBI)