Products 951464-86-1

CAS 951464-86-1 is the registry number for 2-(4-Cyclohexyl-2,3-dioxopiperazin-1-yl)butanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(4-cyclohexyl-2,3-dioxopiperazin-1-yl)butanoic acid (CAS 951464-86-1) is a chemical compound with the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. IUPAC name: 2-(4-cyclohexyl-2,3-dioxopiperazin-1-yl)butanoic acid. InChIKey: HYYOLHPPDRFGFG-UHFFFAOYSA-N.

Identity
Molecular formulaC14H22N2O4
Molecular weight282.34 g/mol
IUPAC name2-(4-cyclohexyl-2,3-dioxopiperazin-1-yl)butanoic acid
InChIKeyHYYOLHPPDRFGFG-UHFFFAOYSA-N
SMILESCCC(C(=O)O)N1CCN(C(=O)C1=O)C2CCCCC2

Computed by PubChem (NCBI)