CAS 2731228-50-3 is the registry number for Trimetazidine N-Oxide. Offered by: Chemat Brand. Available pack sizes: on request.
1-oxido-1-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-ium (CAS 2731228-50-3) is a chemical compound with the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. IUPAC name: 1-oxido-1-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-ium. InChIKey: VSJZAPVLUBQTNX-UHFFFAOYSA-N.
| Molecular formula | C14H22N2O4 |
|---|---|
| Molecular weight | 282.34 g/mol |
| IUPAC name | 1-oxido-1-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-ium |
| InChIKey | VSJZAPVLUBQTNX-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C[N+]2(CCNCC2)[O-])OC)OC |
Computed by PubChem (NCBI)