CAS 61990-51-0 appears in our catalog under these names: Dimepranol Impurity 1, Dimepranol Acedoben, 2–Hydroxy–N，N–dimethylpropan–1–aminium 4–acetamidobenzoate, 2-Hydroxy-N,N-dimethylpropan-1-aminium 4-acetamidobenzoate 97%, 2-Hydroxy-N,N-dimethylpropan-1-aminium 4-acetamidobenzoate, 97%, 97%. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, Ambeed. Available pack sizes: on request, 1g, 2,5g, 25g, 100g, 250g, 5g, 10g.
4-acetamidobenzoic acid;1-(dimethylamino)propan-2-ol (CAS 61990-51-0) is a chemical compound with the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. IUPAC name: 4-acetamidobenzoic acid;1-(dimethylamino)propan-2-ol. InChIKey: FJFQBKRMSCKTSE-UHFFFAOYSA-N.
| Molecular formula | C14H22N2O4 |
|---|---|
| Molecular weight | 282.34 g/mol |
| IUPAC name | 4-acetamidobenzoic acid;1-(dimethylamino)propan-2-ol |
| InChIKey | FJFQBKRMSCKTSE-UHFFFAOYSA-N |
| SMILES | CC(CN(C)C)O.CC(=O)NC1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)