Products 13506-76-8
CAS 13506-76-8 appears in our catalog under these names: 2-Methyl-nitrobenzoic Acid, 2–Methyl–6–nitrobenzoic Acid, 2-Methyl-6-nitrobenzoic acid/ 99%, 2-Methyl-6-nitrobenzoic acid, 98% , 2-Methyl-6-nitrobenzoic acid. Offered by: TRC, GLPBio, Chemat, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 10g, 25g, 5g, 100g, 500g, 1g, 1kg, 50g.
2-methyl-6-nitrobenzoic acid (CAS 13506-76-8) is a chemical compound with the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. IUPAC name: 2-methyl-6-nitrobenzoic acid. InChIKey: CCXSGQZMYLXTOI-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 2-methyl-6-nitrobenzoic acid |
| InChIKey | CCXSGQZMYLXTOI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)