Products 1351238-21-5
CAS 1351238-21-5 is the registry number for 2-chlorothieno[2,3-b]pyrazine-6-carboxylic acid, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
2-chlorothieno[2,3-b]pyrazine-6-carboxylic acid (CAS 1351238-21-5) is a chemical compound with the molecular formula C7H3ClN2O2S and a molecular weight of 214.63 g/mol. IUPAC name: 2-chlorothieno[2,3-b]pyrazine-6-carboxylic acid. InChIKey: MGRFJVQIOLYZDK-UHFFFAOYSA-N.
| Molecular formula | C7H3ClN2O2S |
|---|---|
| Molecular weight | 214.63 g/mol |
| IUPAC name | 2-chlorothieno[2,3-b]pyrazine-6-carboxylic acid |
| InChIKey | MGRFJVQIOLYZDK-UHFFFAOYSA-N |
| SMILES | C1=C(SC2=NC=C(N=C21)Cl)C(=O)O |
Computed by PubChem (NCBI)