CAS 1351395-65-7 appears in our catalog under these names: 3-(5-(Propan-2-yl)-1,3,4-oxadiazol-2-yl)prop-2-enoic acid, 98%, (2E)-3-(5-(Propan-2-yl)-1,3,4-oxadiazol-2-yl)prop-2-enoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 1g, 5g, 50mg, 0,5g.
(E)-3-(5-propan-2-yl-1,3,4-oxadiazol-2-yl)prop-2-enoic acid (CAS 1351395-65-7) is a chemical compound with the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. IUPAC name: (E)-3-(5-propan-2-yl-1,3,4-oxadiazol-2-yl)prop-2-enoic acid. InChIKey: CQPZNSOWDZTHBE-ONEGZZNKSA-N.
| Molecular formula | C8H10N2O3 |
|---|---|
| Molecular weight | 182.18 g/mol |
| IUPAC name | (E)-3-(5-propan-2-yl-1,3,4-oxadiazol-2-yl)prop-2-enoic acid |
| InChIKey | CQPZNSOWDZTHBE-ONEGZZNKSA-N |
| SMILES | CC(C)C1=NN=C(O1)/C=C/C(=O)O |
Computed by PubChem (NCBI)