Products 1351793-97-9

CAS 1351793-97-9 is the registry number for 4-Ethoxy-6-methoxy-8-methylquinoline-2-carboxylic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

4-ethoxy-6-methoxy-8-methylquinoline-2-carboxylic acid (CAS 1351793-97-9) is a chemical compound with the molecular formula C14H15NO4 and a molecular weight of 261.27 g/mol. IUPAC name: 4-ethoxy-6-methoxy-8-methylquinoline-2-carboxylic acid. InChIKey: CAPZWEWYLGWLID-UHFFFAOYSA-N.

Identity
Molecular formulaC14H15NO4
Molecular weight261.27 g/mol
IUPAC name4-ethoxy-6-methoxy-8-methylquinoline-2-carboxylic acid
InChIKeyCAPZWEWYLGWLID-UHFFFAOYSA-N
SMILESCCOC1=CC(=NC2=C1C=C(C=C2C)OC)C(=O)O

Computed by PubChem (NCBI)