CAS 1352208-84-4 is the registry number for 1-(3-Chloro-5-fluorophenyl)-2,2-difluoroethan-1-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(3-chloro-5-fluorophenyl)-2,2-difluoroethanone (CAS 1352208-84-4) is a chemical compound with the molecular formula C8H4ClF3O and a molecular weight of 208.56 g/mol. IUPAC name: 1-(3-chloro-5-fluorophenyl)-2,2-difluoroethanone. InChIKey: CJVBRCXTNRFLAD-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O |
|---|---|
| Molecular weight | 208.56 g/mol |
| IUPAC name | 1-(3-chloro-5-fluorophenyl)-2,2-difluoroethanone |
| InChIKey | CJVBRCXTNRFLAD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)Cl)C(=O)C(F)F |
Computed by PubChem (NCBI)