CAS 1352232-49-5 appears in our catalog under these names: 1-(3-Methoxyphenyl)-2-methylprop-2-en-1-one, 95%, Tapentadol Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3-methoxyphenyl)-2-methylprop-2-en-1-one (CAS 1352232-49-5) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: 1-(3-methoxyphenyl)-2-methylprop-2-en-1-one. InChIKey: BFZSNOGPLIZMBT-UHFFFAOYSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 1-(3-methoxyphenyl)-2-methylprop-2-en-1-one |
| InChIKey | BFZSNOGPLIZMBT-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)C1=CC(=CC=C1)OC |
Computed by PubChem (NCBI)