CAS 1352305-12-4 appears in our catalog under these names: 1-tert-Butyl 2-methyl azepane-1,2-dicarboxylate, 95%, 1-tert-Butyl 2-methyl azepane-1,2-dicarboxylate, 97%, 1-tert-Butyl 2-methyl azepane-1,2-dicarboxylate, 97%, 97%, METHYL 1-BOC-AZEPANE-2-CARBOXYLATE, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 10g, 5g, 100mg, 500mg.
1-O-tert-butyl 2-O-methyl azepane-1,2-dicarboxylate (CAS 1352305-12-4) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl azepane-1,2-dicarboxylate. InChIKey: SLPFKKMDHRUNRM-UHFFFAOYSA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl azepane-1,2-dicarboxylate |
| InChIKey | SLPFKKMDHRUNRM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCCCC1C(=O)OC |
Computed by PubChem (NCBI)