CAS 1352414-88-0 appears in our catalog under these names: N-hydroxy-N-((N',N'-dimethyl)carbamoyl)-benzenesulfonamide, Fasudil Impurity 16. Offered by: Chemat Brand. Available pack sizes: on request.
1-(benzenesulfonyl)-1-hydroxy-3,3-dimethylurea (CAS 1352414-88-0) is a chemical compound with the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. IUPAC name: 1-(benzenesulfonyl)-1-hydroxy-3,3-dimethylurea. InChIKey: VVXSOVNZITYXQI-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O4S |
|---|---|
| Molecular weight | 244.27 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-1-hydroxy-3,3-dimethylurea |
| InChIKey | VVXSOVNZITYXQI-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)N(O)S(=O)(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)