Products 1352907-05-1

CAS 1352907-05-1 appears in our catalog under these names: 1,2-Benzisoxazole-6-carboxylic acid, 95%, 1,2-Benzoxazole-6-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

1,2-benzoxazole-6-carboxylic acid (CAS 1352907-05-1) is a chemical compound with the molecular formula C8H5NO3 and a molecular weight of 163.13 g/mol. IUPAC name: 1,2-benzoxazole-6-carboxylic acid. InChIKey: YOIQHQRSOQNKAU-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5NO3
Molecular weight163.13 g/mol
IUPAC name1,2-benzoxazole-6-carboxylic acid
InChIKeyYOIQHQRSOQNKAU-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1C(=O)O)ON=C2

Computed by PubChem (NCBI)