CAS 1353492-63-3 is the registry number for 6-Bromo-2-methoxyl-9H-carbazole, 99%, 99%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
6-bromo-2-methoxy-9H-carbazole (CAS 1353492-63-3) is a chemical compound with the molecular formula C13H10BrNO and a molecular weight of 276.13 g/mol. IUPAC name: 6-bromo-2-methoxy-9H-carbazole. InChIKey: ZFKAJOPUDZBRPE-UHFFFAOYSA-N.
| Molecular formula | C13H10BrNO |
|---|---|
| Molecular weight | 276.13 g/mol |
| IUPAC name | 6-bromo-2-methoxy-9H-carbazole |
| InChIKey | ZFKAJOPUDZBRPE-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C3=C(N2)C=CC(=C3)Br |
Computed by PubChem (NCBI)