Products 2357110-34-8

CAS 2357110-34-8 is the registry number for Thalidomide-O-C2-alkyne, 99.67%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 100 mg, 50 mg, 10 mg, 5 mg.

Structural formula: {0} (CAS {1})

4-but-3-ynoxy-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (CAS 2357110-34-8) is a chemical compound with the molecular formula C17H14N2O5 and a molecular weight of 326.30 g/mol. IUPAC name: 4-but-3-ynoxy-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione. InChIKey: BXLKIHLKZXMBNK-UHFFFAOYSA-N.

Identity
Molecular formulaC17H14N2O5
Molecular weight326.30 g/mol
IUPAC name4-but-3-ynoxy-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione
InChIKeyBXLKIHLKZXMBNK-UHFFFAOYSA-N
SMILESC#CCCOC1=CC=CC2=C1C(=O)N(C2=O)C3CCC(=O)NC3=O

Computed by PubChem (NCBI)