CAS 1353742-72-9 is the registry number for Methyl (1R,2S)-2-aminocyclobutane-1-carboxylate, trifluoroacetic acid, 98%. Offered by: AmBeed. Available pack sizes: 5g.
Cis-methyl (1R,2S)-2-aminocyclobutane-1-carboxylate;2,2,2-trifluoroacetic acid (CAS 1353742-72-9) is a chemical compound with the molecular formula C8H12F3NO4 and a molecular weight of 243.18 g/mol. IUPAC name: cis-methyl (1R,2S)-2-aminocyclobutane-1-carboxylate;2,2,2-trifluoroacetic acid. InChIKey: FIOCTXILUVEPRM-JBUOLDKXSA-N.
| Molecular formula | C8H12F3NO4 |
|---|---|
| Molecular weight | 243.18 g/mol |
| IUPAC name | cis-methyl (1R,2S)-2-aminocyclobutane-1-carboxylate;2,2,2-trifluoroacetic acid |
| InChIKey | FIOCTXILUVEPRM-JBUOLDKXSA-N |
| SMILES | COC(=O)[C@@H]1CC[C@@H]1N.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)