CAS 1932644-89-7 appears in our catalog under these names: (S)-2-((tert-Butoxycarbonyl)amino)-3,3,3-trifluoropropanoic acid, 98%, (2S)-2-{[(tert-butoxy)carbonyl]amino}-3,3,3-trifluoropropanoic acid, >95%, >95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg.
(2S)-3,3,3-trifluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 1932644-89-7) is a chemical compound with the molecular formula C8H12F3NO4 and a molecular weight of 243.18 g/mol. IUPAC name: (2S)-3,3,3-trifluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: DRKWWMGEXDHBSK-BYPYZUCNSA-N.
| Molecular formula | C8H12F3NO4 |
|---|---|
| Molecular weight | 243.18 g/mol |
| IUPAC name | (2S)-3,3,3-trifluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | DRKWWMGEXDHBSK-BYPYZUCNSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)