Products 2060045-27-2

CAS 2060045-27-2 is the registry number for 3-Aminopropyl prop-2-enoate, trifluoroacetic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.

3-aminopropyl prop-2-enoate;2,2,2-trifluoroacetic acid (CAS 2060045-27-2) is a chemical compound with the molecular formula C8H12F3NO4 and a molecular weight of 243.18 g/mol. IUPAC name: 3-aminopropyl prop-2-enoate;2,2,2-trifluoroacetic acid. InChIKey: NPZKFFAXUGTGOU-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12F3NO4
Molecular weight243.18 g/mol
IUPAC name3-aminopropyl prop-2-enoate;2,2,2-trifluoroacetic acid
InChIKeyNPZKFFAXUGTGOU-UHFFFAOYSA-N
SMILESC=CC(=O)OCCCN.C(=O)(C(F)(F)F)O

Computed by PubChem (NCBI)