CAS 1797923-92-2 appears in our catalog under these names: 2-(Azetidin-3-yl)propanoic acid, trifluoroacetic acid, 2-(azetidin-3-yl)propanoic acid, trifluoroacetic acid, 97%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 5g, 10g.
2-(azetidin-3-yl)propanoic acid;2,2,2-trifluoroacetic acid (CAS 1797923-92-2) is a chemical compound with the molecular formula C8H12F3NO4 and a molecular weight of 243.18 g/mol. IUPAC name: 2-(azetidin-3-yl)propanoic acid;2,2,2-trifluoroacetic acid. InChIKey: SCMKIRSEQAWRIB-UHFFFAOYSA-N.
| Molecular formula | C8H12F3NO4 |
|---|---|
| Molecular weight | 243.18 g/mol |
| IUPAC name | 2-(azetidin-3-yl)propanoic acid;2,2,2-trifluoroacetic acid |
| InChIKey | SCMKIRSEQAWRIB-UHFFFAOYSA-N |
| SMILES | CC(C1CNC1)C(=O)O.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)