Products 2306276-25-3

CAS 2306276-25-3 is the registry number for Methyl 2-aminocyclobutane-1-carboxylate trifluoroacetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Methyl 2-aminocyclobutane-1-carboxylate;2,2,2-trifluoroacetic acid (CAS 2306276-25-3) is a chemical compound with the molecular formula C8H12F3NO4 and a molecular weight of 243.18 g/mol. IUPAC name: methyl 2-aminocyclobutane-1-carboxylate;2,2,2-trifluoroacetic acid. InChIKey: FIOCTXILUVEPRM-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12F3NO4
Molecular weight243.18 g/mol
IUPAC namemethyl 2-aminocyclobutane-1-carboxylate;2,2,2-trifluoroacetic acid
InChIKeyFIOCTXILUVEPRM-UHFFFAOYSA-N
SMILESCOC(=O)C1CCC1N.C(=O)(C(F)(F)F)O

Computed by PubChem (NCBI)