CAS 51996-45-3 is the registry number for Daunorubicin Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(2S,3S,4S,6R)-3,6-dihydroxy-2-methyloxan-4-yl]-2,2,2-trifluoroacetamide (CAS 51996-45-3) is a chemical compound with the molecular formula C8H12F3NO4 and a molecular weight of 243.18 g/mol. IUPAC name: N-[(2S,3S,4S,6R)-3,6-dihydroxy-2-methyloxan-4-yl]-2,2,2-trifluoroacetamide. InChIKey: KDSJJWJDPYHURS-UNTFVMJOSA-N.
| Molecular formula | C8H12F3NO4 |
|---|---|
| Molecular weight | 243.18 g/mol |
| IUPAC name | N-[(2S,3S,4S,6R)-3,6-dihydroxy-2-methyloxan-4-yl]-2,2,2-trifluoroacetamide |
| InChIKey | KDSJJWJDPYHURS-UNTFVMJOSA-N |
| SMILES | C[C@H]1[C@H]([C@H](C[C@@H](O1)O)NC(=O)C(F)(F)F)O |
Computed by PubChem (NCBI)