Products 13541-19-0
CAS 13541-19-0 appears in our catalog under these names: 1-(4-Bromophenyl)-3,3,3-trifluoropropan-1-ol, 95%, 1-(4-Bromophenyl)-3,3,3-trifluoropropan-1-ol. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
1-(4-bromophenyl)-3,3,3-trifluoropropan-1-ol (CAS 13541-19-0) is a chemical compound with the molecular formula C9H8BrF3O and a molecular weight of 269.06 g/mol. IUPAC name: 1-(4-bromophenyl)-3,3,3-trifluoropropan-1-ol. InChIKey: FWZFEMQGRLKIGH-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF3O |
|---|---|
| Molecular weight | 269.06 g/mol |
| IUPAC name | 1-(4-bromophenyl)-3,3,3-trifluoropropan-1-ol |
| InChIKey | FWZFEMQGRLKIGH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(CC(F)(F)F)O)Br |
Computed by PubChem (NCBI)