CAS 1354930-93-0 is the registry number for 3-(4-bromophenyl)-1,2-oxazol-5-ol, 95%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
3-(4-bromophenyl)-2H-1,2-oxazol-5-one (CAS 1354930-93-0) is a chemical compound with the molecular formula C9H6BrNO2 and a molecular weight of 240.05 g/mol. IUPAC name: 3-(4-bromophenyl)-2H-1,2-oxazol-5-one. InChIKey: SJZVBCDBPNOPHV-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2 |
|---|---|
| Molecular weight | 240.05 g/mol |
| IUPAC name | 3-(4-bromophenyl)-2H-1,2-oxazol-5-one |
| InChIKey | SJZVBCDBPNOPHV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=O)ON2)Br |
Computed by PubChem (NCBI)