CAS 1354962-20-1 appears in our catalog under these names: 3-(2,4-Difluorophenyl)-3-acetamidopropanoic acid, 95%, 3-(2,4-Difluorophenyl)-3-acetamidopropanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
3-acetamido-3-(2,4-difluorophenyl)propanoic acid (CAS 1354962-20-1) is a chemical compound with the molecular formula C11H11F2NO3 and a molecular weight of 243.21 g/mol. IUPAC name: 3-acetamido-3-(2,4-difluorophenyl)propanoic acid. InChIKey: MONNSOYJCUCULT-UHFFFAOYSA-N.
| Molecular formula | C11H11F2NO3 |
|---|---|
| Molecular weight | 243.21 g/mol |
| IUPAC name | 3-acetamido-3-(2,4-difluorophenyl)propanoic acid |
| InChIKey | MONNSOYJCUCULT-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(CC(=O)O)C1=C(C=C(C=C1)F)F |
Computed by PubChem (NCBI)