CAS 135531-89-4 appears in our catalog under these names: 4-Nitro-1H-indol-5-ol, 4-Nitro-1H-indol-5-ol, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
4-nitro-1H-indol-5-ol (CAS 135531-89-4) is a chemical compound with the molecular formula C8H6N2O3 and a molecular weight of 178.14 g/mol. IUPAC name: 4-nitro-1H-indol-5-ol. InChIKey: RETYFVFLZKTNQL-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 4-nitro-1H-indol-5-ol |
| InChIKey | RETYFVFLZKTNQL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1NC=C2)[N+](=O)[O-])O |
Computed by PubChem (NCBI)