CAS 13555-16-3 is the registry number for Fmoc-D-Cpg-OH. Offered by: Creative Peptides. Available pack sizes: on request.
(2R)-2-cyclopentyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid (CAS 13555-16-3) is a chemical compound with the molecular formula C22H23NO4 and a molecular weight of 365.4 g/mol. IUPAC name: (2R)-2-cyclopentyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid. InChIKey: JGWHUIQSEKGLAQ-HXUWFJFHSA-N.
| Molecular formula | C22H23NO4 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | (2R)-2-cyclopentyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid |
| InChIKey | JGWHUIQSEKGLAQ-HXUWFJFHSA-N |
| SMILES | C1CCC(C1)[C@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)