CAS 220497-61-0 appears in our catalog under these names: Fmoc-cyclopentyl-Gly-OH, 97%, Fmoc–Cpg–OH, Fmoc-L-cycPentGly-OH, Fmoc-L-cyclopentylglycine, Fmoc-Cpg-OH 98%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Biosynth, Ambeed. Available pack sizes: 10g, 25g, 1g, 100g, 5g, 250mg, 500mg, 1000mg.
(2S)-2-cyclopentyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid (CAS 220497-61-0) is a chemical compound with the molecular formula C22H23NO4 and a molecular weight of 365.4 g/mol. IUPAC name: (2S)-2-cyclopentyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid. InChIKey: JGWHUIQSEKGLAQ-FQEVSTJZSA-N.
| Molecular formula | C22H23NO4 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | (2S)-2-cyclopentyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid |
| InChIKey | JGWHUIQSEKGLAQ-FQEVSTJZSA-N |
| SMILES | C1CCC(C1)[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)