CAS 136555-16-3 appears in our catalog under these names: Fmoc-cyclopentyl-D-Gly-OH, 97%, Fmoc-D-Cpg-OH, Fmoc-D-Gly(cyclopentyl)-OH 98%, (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-cyclopentylacetic acid, 98%, 98%, (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-cyclopentylacetic acid, 97%. Offered by: Combi-blocks, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 1g, 5g, 250mg, 100mg.
(2R)-2-cyclopentyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid (CAS 136555-16-3) is a chemical compound with the molecular formula C22H23NO4 and a molecular weight of 365.4 g/mol. IUPAC name: (2R)-2-cyclopentyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid. InChIKey: JGWHUIQSEKGLAQ-HXUWFJFHSA-N.
| Molecular formula | C22H23NO4 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | (2R)-2-cyclopentyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid |
| InChIKey | JGWHUIQSEKGLAQ-HXUWFJFHSA-N |
| SMILES | C1CCC(C1)[C@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)