Products 1356841-28-5
CAS 1356841-28-5 appears in our catalog under these names: Aspartame-D3, Aspartame–d3. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 1 mg, 10 mg.
(3S)-3-amino-4-oxo-4-[[(2S)-1-oxo-3-phenyl-1-(trideuteriomethoxy)propan-2-yl]amino]butanoic acid (CAS 1356841-28-5) is a chemical compound with the molecular formula C14H18N2O5 and a molecular weight of 297.32 g/mol. IUPAC name: (3S)-3-amino-4-oxo-4-[[(2S)-1-oxo-3-phenyl-1-(trideuteriomethoxy)propan-2-yl]amino]butanoic acid. InChIKey: IAOZJIPTCAWIRG-JRDZZGLNSA-N.
| Molecular formula | C14H18N2O5 |
|---|---|
| Molecular weight | 297.32 g/mol |
| IUPAC name | (3S)-3-amino-4-oxo-4-[[(2S)-1-oxo-3-phenyl-1-(trideuteriomethoxy)propan-2-yl]amino]butanoic acid |
| InChIKey | IAOZJIPTCAWIRG-JRDZZGLNSA-N |
| SMILES | [2H]C([2H])([2H])OC(=O)[C@H](CC1=CC=CC=C1)NC(=O)[C@H](CC(=O)O)N |
Computed by PubChem (NCBI)