Products 1356849-17-6
CAS 1356849-17-6 appears in our catalog under these names: Aspartame-d5, Aspartame-d5, >95% (HPLC), Aspartame–d5. Offered by: Chemat Brand, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 1 mg.
(3S)-3-amino-4-[[(2S)-1-methoxy-1-oxo-3-(2,3,4,5,6-pentadeuteriophenyl)propan-2-yl]amino]-4-oxobutanoic acid (CAS 1356849-17-6) is a chemical compound with the molecular formula C14H18N2O5 and a molecular weight of 299.33 g/mol. IUPAC name: (3S)-3-amino-4-[[(2S)-1-methoxy-1-oxo-3-(2,3,4,5,6-pentadeuteriophenyl)propan-2-yl]amino]-4-oxobutanoic acid. InChIKey: IAOZJIPTCAWIRG-HEPISUNPSA-N.
| Molecular formula | C14H18N2O5 |
|---|---|
| Molecular weight | 299.33 g/mol |
| IUPAC name | (3S)-3-amino-4-[[(2S)-1-methoxy-1-oxo-3-(2,3,4,5,6-pentadeuteriophenyl)propan-2-yl]amino]-4-oxobutanoic acid |
| InChIKey | IAOZJIPTCAWIRG-HEPISUNPSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C[C@@H](C(=O)OC)NC(=O)[C@H](CC(=O)O)N)[2H])[2H] |
Computed by PubChem (NCBI)