CAS 1360623-95-5 appears in our catalog under these names: 3-AMINO-2,4-DICHLOROBENZAMIDE, 95%, 95%, 3-Amino-2,4-dichlorobenzamide 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
3-amino-2,4-dichlorobenzamide (CAS 1360623-95-5) is a chemical compound with the molecular formula C7H6Cl2N2O and a molecular weight of 205.04 g/mol. IUPAC name: 3-amino-2,4-dichlorobenzamide. InChIKey: PCUKSZVLKIIZRT-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2O |
|---|---|
| Molecular weight | 205.04 g/mol |
| IUPAC name | 3-amino-2,4-dichlorobenzamide |
| InChIKey | PCUKSZVLKIIZRT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)N)Cl)N)Cl |
Computed by PubChem (NCBI)