CAS 1360886-58-3 appears in our catalog under these names: 5-Bromo-7-methoxyindolin-2-one, 97%, 5-Bromo-7-methoxy-2,3-dihydro-1H-indol-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 1g, 5g, 0,5g, 50mg.
5-bromo-7-methoxy-1,3-dihydroindol-2-one (CAS 1360886-58-3) is a chemical compound with the molecular formula C9H8BrNO2 and a molecular weight of 242.07 g/mol. IUPAC name: 5-bromo-7-methoxy-1,3-dihydroindol-2-one. InChIKey: BKUJJUFNTYIDPI-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO2 |
|---|---|
| Molecular weight | 242.07 g/mol |
| IUPAC name | 5-bromo-7-methoxy-1,3-dihydroindol-2-one |
| InChIKey | BKUJJUFNTYIDPI-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC2=C1NC(=O)C2)Br |
Computed by PubChem (NCBI)