CAS 1361046-86-7 appears in our catalog under these names: 4,4,5,5-Tetramethyl-2-(pent-1-en-2-yl)-1,3,2-dioxaborolane, 98%, 4,4,5,5-Tetramethyl-2-(pent-1-en-2-yl)-1,3,2-dioxaborolane, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
4,4,5,5-tetramethyl-2-pent-1-en-2-yl-1,3,2-dioxaborolane (CAS 1361046-86-7) is a chemical compound with the molecular formula C11H21BO2 and a molecular weight of 196.10 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-pent-1-en-2-yl-1,3,2-dioxaborolane. InChIKey: GCYIFXCXTTWRIB-UHFFFAOYSA-N.
| Molecular formula | C11H21BO2 |
|---|---|
| Molecular weight | 196.10 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-pent-1-en-2-yl-1,3,2-dioxaborolane |
| InChIKey | GCYIFXCXTTWRIB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C(=C)CCC |
Computed by PubChem (NCBI)