CAS 2923733-53-1 is the registry number for 2-((1R,2R)-2-Ethylcyclopropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-[(1R,2R)-2-ethylcyclopropyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2923733-53-1) is a chemical compound with the molecular formula C11H21BO2 and a molecular weight of 196.10 g/mol. IUPAC name: 2-[(1R,2R)-2-ethylcyclopropyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: KOKIOKRQOCRQHK-RKDXNWHRSA-N.
| Molecular formula | C11H21BO2 |
|---|---|
| Molecular weight | 196.10 g/mol |
| IUPAC name | 2-[(1R,2R)-2-ethylcyclopropyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | KOKIOKRQOCRQHK-RKDXNWHRSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)[C@@H]2C[C@H]2CC |
Computed by PubChem (NCBI)