CAS 1422558-28-8 appears in our catalog under these names: 2–(cyclobutylmethyl)–4,4,5,5–tetramethyl–1,3,2–dioxaborolane, 2-(cyclobutylmethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 97%. Offered by: GLPBio, Chemat. Available pack sizes: 200mg, 100mg, 250mg, 1g, 5g.
2-(cyclobutylmethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1422558-28-8) is a chemical compound with the molecular formula C11H21BO2 and a molecular weight of 196.10 g/mol. IUPAC name: 2-(cyclobutylmethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: KAOGTTNKADLLPW-UHFFFAOYSA-N.
| Molecular formula | C11H21BO2 |
|---|---|
| Molecular weight | 196.10 g/mol |
| IUPAC name | 2-(cyclobutylmethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | KAOGTTNKADLLPW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC2CCC2 |
Computed by PubChem (NCBI)