Products 136131-34-5

CAS 136131-34-5 is the registry number for 3-(4-Methoxybenzyl)furan, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

3-[(4-methoxyphenyl)methyl]furan (CAS 136131-34-5) is a chemical compound with the molecular formula C12H12O2 and a molecular weight of 188.22 g/mol. IUPAC name: 3-[(4-methoxyphenyl)methyl]furan. InChIKey: ZFEWMRAZXABKCQ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12O2
Molecular weight188.22 g/mol
IUPAC name3-[(4-methoxyphenyl)methyl]furan
InChIKeyZFEWMRAZXABKCQ-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)CC2=COC=C2

Computed by PubChem (NCBI)