CAS 13615-41-3 is the registry number for Indoleglycerol. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.
1-(1H-indol-3-yl)propane-1,2,3-triol (CAS 13615-41-3) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: 1-(1H-indol-3-yl)propane-1,2,3-triol. InChIKey: XINKZRRAVQNCLX-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | 1-(1H-indol-3-yl)propane-1,2,3-triol |
| InChIKey | XINKZRRAVQNCLX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C(C(CO)O)O |
Computed by PubChem (NCBI)