CAS 13621-23-3 is the registry number for 1-(2,4-Dimethyl-5-nitrophenyl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
1-(2,4-dimethyl-5-nitrophenyl)ethanone (CAS 13621-23-3) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: 1-(2,4-dimethyl-5-nitrophenyl)ethanone. InChIKey: HKWHXCZNPRLETD-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | 1-(2,4-dimethyl-5-nitrophenyl)ethanone |
| InChIKey | HKWHXCZNPRLETD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C(=O)C)[N+](=O)[O-])C |
Computed by PubChem (NCBI)