CAS 1362819-50-8 appears in our catalog under these names: 4-Bromo-2-hydroxy-5-methylbenzoic acid, 98%, 4-Bromo-2-hydroxy-5-methylbenzoic Acid, ≥95%, ≥95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg.
4-bromo-2-hydroxy-5-methylbenzoic acid (CAS 1362819-50-8) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: 4-bromo-2-hydroxy-5-methylbenzoic acid. InChIKey: OOGKJQAQYKNXKV-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | 4-bromo-2-hydroxy-5-methylbenzoic acid |
| InChIKey | OOGKJQAQYKNXKV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Br)O)C(=O)O |
Computed by PubChem (NCBI)