Products 13629-22-6
CAS 13629-22-6 appears in our catalog under these names: 9-Fluorenone hydrazone, 96%, 9–Fluorenone hydrazone, 9-Fluorenone hydrazone, (9H-Fluoren-9-ylidene)hydrazine 95%, (9H-Fluoren-9-ylidene)hydrazine, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 25g, 5g, 100g, 250g, 10g.
Fluoren-9-ylidenehydrazine (CAS 13629-22-6) is a chemical compound with the molecular formula C13H10N2 and a molecular weight of 194.23 g/mol. IUPAC name: fluoren-9-ylidenehydrazine. InChIKey: YCNUILAKOMIBAL-UHFFFAOYSA-N.
| Molecular formula | C13H10N2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | fluoren-9-ylidenehydrazine |
| InChIKey | YCNUILAKOMIBAL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3C2=NN |
Computed by PubChem (NCBI)