CAS 1363380-51-1 appears in our catalog under these names: 5-Chloro-3-nitro-pyrazolo(1,5-a)pyrimidine, >95% (HPLC), 5-Chloro-3-nitropyrazolo(1,5-a)pyrimidine, 5-CHLORO-3-NITROPYRAZOLO[1,5-A]PYRIMIDINE, 97%, 5-Chloro-3-nitropyrazolo[1,5-a]pyrimidine, 95%. Offered by: TRC, Biosynth, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 500mg, 100g, 5g, 10g, 25g.
5-chloro-3-nitropyrazolo[1,5-a]pyrimidine (CAS 1363380-51-1) is a chemical compound with the molecular formula C6H3ClN4O2 and a molecular weight of 198.57 g/mol. IUPAC name: 5-chloro-3-nitropyrazolo[1,5-a]pyrimidine. InChIKey: VYEUPRYCLWAOMU-UHFFFAOYSA-N.
| Molecular formula | C6H3ClN4O2 |
|---|---|
| Molecular weight | 198.57 g/mol |
| IUPAC name | 5-chloro-3-nitropyrazolo[1,5-a]pyrimidine |
| InChIKey | VYEUPRYCLWAOMU-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C(C=N2)[N+](=O)[O-])N=C1Cl |
Computed by PubChem (NCBI)