Products 878011-46-2
CAS 878011-46-2 is the registry number for 7-chloro-5-nitro-3H-imidazo[4,5-b]pyridine, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
7-chloro-5-nitro-1H-imidazo[4,5-b]pyridine (CAS 878011-46-2) is a chemical compound with the molecular formula C6H3ClN4O2 and a molecular weight of 198.57 g/mol. IUPAC name: 7-chloro-5-nitro-1H-imidazo[4,5-b]pyridine. InChIKey: IIUUFWOVTHHNDR-UHFFFAOYSA-N.
| Molecular formula | C6H3ClN4O2 |
|---|---|
| Molecular weight | 198.57 g/mol |
| IUPAC name | 7-chloro-5-nitro-1H-imidazo[4,5-b]pyridine |
| InChIKey | IIUUFWOVTHHNDR-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(N=CN2)N=C1[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)