Products 2639294-43-0
CAS 2639294-43-0 is the registry number for 4-Chloro-1H-pyrazolo[3,4-d]pyrimidine-3-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-2H-pyrazolo[3,4-d]pyrimidine-3-carboxylic acid (CAS 2639294-43-0) is a chemical compound with the molecular formula C6H3ClN4O2 and a molecular weight of 198.57 g/mol. IUPAC name: 4-chloro-2H-pyrazolo[3,4-d]pyrimidine-3-carboxylic acid. InChIKey: XCBACPUHKACOCZ-UHFFFAOYSA-N.
| Molecular formula | C6H3ClN4O2 |
|---|---|
| Molecular weight | 198.57 g/mol |
| IUPAC name | 4-chloro-2H-pyrazolo[3,4-d]pyrimidine-3-carboxylic acid |
| InChIKey | XCBACPUHKACOCZ-UHFFFAOYSA-N |
| SMILES | C1=NC2=NNC(=C2C(=N1)Cl)C(=O)O |
Computed by PubChem (NCBI)