CAS 2837903-50-9 is the registry number for 3-Chloropyrimido[5,4-c]pyridazine-6,8(5H,7H)-dione 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
3-chloro-5H-pyrimido[5,4-c]pyridazine-6,8-dione (CAS 2837903-50-9) is a chemical compound with the molecular formula C6H3ClN4O2 and a molecular weight of 198.57 g/mol. IUPAC name: 3-chloro-5H-pyrimido[5,4-c]pyridazine-6,8-dione. InChIKey: QMSKNNPVPDBUCQ-UHFFFAOYSA-N.
| Molecular formula | C6H3ClN4O2 |
|---|---|
| Molecular weight | 198.57 g/mol |
| IUPAC name | 3-chloro-5H-pyrimido[5,4-c]pyridazine-6,8-dione |
| InChIKey | QMSKNNPVPDBUCQ-UHFFFAOYSA-N |
| SMILES | C1=C2C(=NN=C1Cl)C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)